3-BROMOQUINOLIN-2(1H)-ONE
Catalog No: FT-0647352
CAS No: 939-16-2
- Chemical Name: 3-BROMOQUINOLIN-2(1H)-ONE
- Molecular Formula: C9H6BrNO
- Molecular Weight: 224.05
- InChI Key: AGARPHPERRYPRP-UHFFFAOYSA-N
- InChI: InChI=1S/C9H6BrNO/c10-7-5-6-3-1-2-4-8(6)11-9(7)12/h1-5H,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-Bromo-2(1H)-quinolinone |
|---|---|
| Bolling_Point: | 395.2±42.0 °C at 760 mmHg |
| MF: | C9H6BrNO |
| Symbol: | GHS05, GHS07 |
| Melting_Point: | N/A |
| CAS: | 939-16-2 |
| Density: | 1.7±0.1 g/cm3 |
| FW: | 224.054 |
| Flash_Point: | 192.8±27.9 °C |
| Exact_Mass: | 222.963272 |
|---|---|
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| MF: | C9H6BrNO |
| LogP: | 1.62 |
| Bolling_Point: | 395.2±42.0 °C at 760 mmHg |
| Density: | 1.7±0.1 g/cm3 |
| PSA: | 33.12000 |
| FW: | 224.054 |
| Flash_Point: | 192.8±27.9 °C |
| Refractive_Index: | 1.654 |
| HS_Code: | 2933790090 |
|---|---|
| Safety_Statements: | H302-H315-H318-H335 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Symbol: | GHS05, GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)